Ergosterol biosynthesis (Saccharomyces cerevisiae)
From WikiPathways
Description
This pathway is inspired by the LipidMaps, Sterol lipids expended pathway display (https://lipidmaps.org/pathway/pathways_maps) and extended with Scheme 1 from Acimovic et al 2013. Literature suggests that cholesterol synthesis preferentially starts with the Bloch pathway, however there is a shift to the Kandutsch-Russell part via lathosterol from Bae et al, 1997. Dashed lines indicate that multiple steps are involved to create the final product.
Quality Tags
Ontology Terms
Pathway Ontology : fatty acid beta degradation pathway
Bibliography
- Bhattacharya S, Esquivel BD, White TC; ''Overexpression or Deletion of Ergosterol Biosynthesis Genes Alters Doubling Time, Response to Stress Agents, and Drug Susceptibility in Saccharomyces cerevisiae.''; mBio, 2018 PubMed Europe PMC Scholia
- Mazein A, Watterson S, Hsieh WY, Griffiths WJ, Ghazal P; ''A comprehensive machine-readable view of the mammalian cholesterol biosynthesis pathway.''; Biochem Pharmacol, 2013 PubMed Europe PMC Scholia
- Bae SH, Paik YK; ''Cholesterol biosynthesis from lanosterol: development of a novel assay method and characterization of rat liver microsomal lanosterol delta 24-reductase.''; Biochem J, 1997 PubMed Europe PMC Scholia
- Ačimovič J, Rozman D; ''Steroidal triterpenes of cholesterol synthesis.''; Molecules, 2013 PubMed Europe PMC Scholia
History
View all... |
External references
DataNodes
View all... |
Name ![]() | Type ![]() | Database reference ![]() | Comment ![]() |
---|---|---|---|
3-keto-4alpha-methyl-zymosterol | Metabolite | LMST01010237 (LIPID MAPS) ![]() | |
32-Oxolanosterol | Metabolite | LMST01010222 (LIPID MAPS) ![]() | |
32-hydroxylanosterol | Metabolite | LMST01010124 (LIPID MAPS) ![]() | |
4,4-dimethylcholesta-8,11,24-trienol | Metabolite | LMST01010149 (LIPID MAPS) ![]() | |
4,4-dimethylzymosterol | Metabolite | LMST01010176 (LIPID MAPS) ![]() | |
4-methyl-4-carboxy zymosterone | Metabolite | LMST01010388 (LIPID MAPS) ![]() | C12CC[C@@]3([H])C(C)(COOH)[C@@H](O)CC[C@]3(C)C=1CC[C@]1(C)[C@@]([H])([C@@](C)([H])CC/C=C(\C)/C)CC[C]21H |
4alpha-methyl zymosterol | Metabolite | LMST01010202 (LIPID MAPS) ![]() | C12CC[C@@]3([H])C(C)[C@@H](O)CC[C@]3(C)C=1CC[C@]1(C)[C@@]([H])([C@@](C)([H])CC/C=C(\C)/C)CC[C]21H |
4α-carboxyzymosterol | Metabolite | LMST01010522 (LIPID MAPS) ![]() | |
4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010229 (LIPID MAPS) ![]() | |
4α-formyl-5α- cholesta-8,24-dien-3β-ol | Metabolite | LMST01010226 (LIPID MAPS) ![]() | |
4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010234 (LIPID MAPS) ![]() | |
4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010232 (LIPID MAPS) ![]() | |
5-dehydroepisterol | Metabolite | LMST01030135 (LIPID MAPS) ![]() | |
Acetoacetyl-CoA | Metabolite | LMFA07050030 (LIPID MAPS) ![]() | |
Acetyl-CoA | Metabolite | LMFA07050281 (LIPID MAPS) ![]() | |
Dimethylallyl-PP | Metabolite | LMPR01010001 (LIPID MAPS) ![]() | |
ERG10 | GeneProduct | P41338 (Uniprot-TrEMBL) ![]() | |
ERG11 | Protein | P10614 (Uniprot-TrEMBL) ![]() | |
ERG12 | GeneProduct | P07277 (Uniprot-TrEMBL) ![]() | |
ERG13 | GeneProduct | P54839 (Uniprot-TrEMBL) ![]() | |
ERG19 | GeneProduct | P32377 (Uniprot-TrEMBL) ![]() | |
ERG1 | GeneProduct | P32476 (Uniprot-TrEMBL) ![]() | |
ERG24 | GeneProduct | P32462 (Uniprot-TrEMBL) ![]() | |
ERG25 | Protein | P53045 (Uniprot-TrEMBL) ![]() | |
ERG26 | GeneProduct | P53199 (Uniprot-TrEMBL) ![]() | |
ERG27 | Protein | Q12452 (Uniprot-TrEMBL) ![]() | |
ERG2 | GeneProduct | P32352 (Uniprot-TrEMBL) ![]() | |
ERG3 | GeneProduct | P32353 (Uniprot-TrEMBL) ![]() | |
ERG4 | GeneProduct | P25340 (Uniprot-TrEMBL) ![]() | |
ERG5 | GeneProduct | P54781 (Uniprot-TrEMBL) ![]() | |
ERG6 | GeneProduct | P25087 (Uniprot-TrEMBL) ![]() | |
ERG7 | GeneProduct | P38604 (Uniprot-TrEMBL) ![]() | |
ERG8 | GeneProduct | P24521 (Uniprot-TrEMBL) ![]() | |
ERG9 | GeneProduct | P29704 (Uniprot-TrEMBL) ![]() | |
Eburicol | Metabolite | LMST01031311 (LIPID MAPS) ![]() | |
Episterol | Metabolite | LMST01030115 (LIPID MAPS) ![]() | |
Ergosterol | Metabolite | LMST01030093 (LIPID MAPS) ![]() | |
Farnesyl-PP | Metabolite | LMPR0103010002 (LIPID MAPS) ![]() | |
Fecosterol | Metabolite | LMST01030095 (LIPID MAPS) ![]() | aka 24-dehydrolathosterol |
Geranyl-PP | Metabolite | LMPR0102010001 (LIPID MAPS) ![]() | |
Ggps1 | GeneProduct | 14593 (Entrez Gene) ![]() | |
HMG-CoA | Metabolite | LMFA07050116 (LIPID MAPS) ![]() | |
HMG1 | GeneProduct | P12683 (Uniprot-TrEMBL) ![]() | |
HMG2 | GeneProduct | P12684 (Uniprot-TrEMBL) ![]() | |
IDI1 | GeneProduct | P15496 (Uniprot-TrEMBL) ![]() | |
IPP | Metabolite | LMPR01010008 (LIPID MAPS) ![]() | |
Isopentenyl-PP | Metabolite | LMPR01010008 (LIPID MAPS) ![]() | |
Lanosterol | Metabolite | LMST01010017 (LIPID MAPS) ![]() | |
Mevalonate-5-P | Metabolite | LMFA01050415 (LIPID MAPS) ![]() | |
Mevalonate-5-PP | Metabolite | LMFA01050416 (LIPID MAPS) ![]() | |
Mevalonic acid | Metabolite | LMFA01050352 (LIPID MAPS) ![]() | |
PreSqualene-PP | Metabolite | LMPR0106010003 (LIPID MAPS) ![]() | Annotated while assuming this compound is actually presqualene-diphosphate |
Squalene-2,3-epoxide | Metabolite | LMPR0106010010 (LIPID MAPS) ![]() | |
Squalene | Metabolite | LMPR0106010002 (LIPID MAPS) ![]() | |
Zymosterol | Metabolite | LMST01010066 (LIPID MAPS) ![]() | |
Zymosterone | Metabolite | LMST01010168 (LIPID MAPS) ![]() | |
ergosta-5,7,22,24(28)-tetraen-3beta-ol | Metabolite | LMST01031015 (LIPID MAPS) ![]() |
Annotated Interactions
View all... |
Source ![]() | Target ![]() | Type ![]() | Database reference ![]() | Comment ![]() |
---|---|---|---|---|
3-keto-4alpha-methyl-zymosterol | 4alpha-methyl zymosterol | mim-conversion | 36380 (Rhea) ![]() | EC:1.1.1.270 |
4,4-dimethylcholesta-8,11,24-trienol | 4,4-dimethylzymosterol | mim-conversion | 18563 (Rhea) ![]() | EC:1.3.1.70 |
4,4-dimethylzymosterol | 4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 47061 (Rhea) ![]() | EC:1.14.18.9 |
4,4-dimethylzymosterol | mim-conversion | 55245 (Rhea) ![]() | EC:1.14.18.9 | |
4-methyl-4-carboxy zymosterone | 3-keto-4alpha-methyl-zymosterol | mim-conversion | 33448 (Rhea) ![]() | EC:1.1.1.170 |
4alpha-methyl zymosterol | 4α-carboxyzymosterol | mim-conversion | 47056 (Rhea) ![]() | EC:1.14.18.9 |
4alpha-methyl zymosterol | 4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 46473 (Rhea) ![]() | EC:1.14.18.9 |
4α-carboxyzymosterol | Zymosterone | mim-conversion | 33456 (Rhea) ![]() | EC:1.1.1.170 |
4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | 4-methyl-4-carboxy zymosterone | mim-conversion | 47069 (Rhea) ![]() | EC:1.14.18.9 |
4α-formyl-5α- cholesta-8,24-dien-3β-ol | 4α-carboxyzymosterol | mim-conversion | 46481 (Rhea) ![]() | EC:1.14.18.9 |
4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | 4α-formyl-5α- cholesta-8,24-dien-3β-ol | mim-conversion | 46477 (Rhea) ![]() | EC:1.14.18.9 |
4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | 4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 47065 (Rhea) ![]() | EC:1.14.18.9 |
5-dehydroepisterol | ergosta-5,7,22,24(28)-tetraen-3beta-ol | mim-conversion | 33468 (Rhea) ![]() | EC:1.14.19.41 |
Acetoacetyl-CoA | HMG-CoA | mim-conversion | 10189 (Rhea) ![]() | EC:2.3.3.10 |
Acetyl-CoA | Acetoacetyl-CoA | mim-conversion | 21037 (Rhea) ![]() | EC:2.3.1.9 |
Acetyl-CoA | HMG-CoA | mim-conversion | 10189 (Rhea) ![]() | EC:2.3.3.10 |
Dimethylallyl-PP | Geranyl-PP | mim-conversion | 22409 (Rhea) ![]() | EC:2.5.1.1 |
Episterol | 5-dehydroepisterol | mim-conversion | 46561 (Rhea) ![]() | EC:1.14.19.20 |
Farnesyl-PP | PreSqualene-PP | mim-conversion | 22673 (Rhea) ![]() | EC:2.5.1.103 |
Fecosterol | Episterol | mim-conversion | 33436 (Rhea) ![]() | |
Geranyl-PP | Farnesyl-PP | mim-conversion | 19362 (Rhea) ![]() | EC:2.5.1.10 |
HMG-CoA | Mevalonic acid | mim-conversion | 15991 (Rhea) ![]() | EC:1.1.1.34 |
IPP | Farnesyl-PP | mim-conversion | 19362 (Rhea) ![]() | EC:2.5.1.10 |
IPP | Geranyl-PP | mim-conversion | 22409 (Rhea) ![]() | EC:2.5.1.1 |
Isopentenyl-PP | Dimethylallyl-PP | mim-conversion | 23285 (Rhea) ![]() | EC:5.3.3.2 |
Lanosterol | Eburicol | mim-conversion | 52653 (Rhea) ![]() | |
Lanosterol | mim-conversion | 25287 (Rhea) ![]() | EC:1.14.14.154 | |
Mevalonate-5-P | Mevalonate-5-PP | mim-conversion | 16342 (Rhea) ![]() | EC:2.7.4.2 |
Mevalonate-5-PP | Isopentenyl-PP | mim-conversion | 23733 (Rhea) ![]() | EC:4.1.1.33 |
Mevalonic acid | Mevalonate-5-P | mim-conversion | 17066 (Rhea) ![]() | EC:2.7.1.36 |
PreSqualene-PP | Squalene | mim-conversion | 22229 (Rhea) ![]() | EC:2.5.1.103 |
Squalene-2,3-epoxide | Lanosterol | mim-conversion | 14622 (Rhea) ![]() | EC:5.4.99.7 |
Squalene | Squalene-2,3-epoxide | mim-conversion | 25283 (Rhea) ![]() | EC:1.14.14.17 |
Zymosterol | Fecosterol | mim-conversion | 34000 (Rhea) ![]() | EC:2.1.1.41 |
Zymosterone | Zymosterol | mim-conversion | 33460 (Rhea) ![]() | EC:1.1.1.270 |
ergosta-5,7,22,24(28)-tetraen-3beta-ol | Ergosterol | mim-conversion | 18503 (Rhea) ![]() | EC:1.3.1.71 |