Ergosterol biosynthesis (Saccharomyces cerevisiae)
From WikiPathways
Description
This pathway is inspired by the LipidMaps, Sterol lipids expended pathway display (https://lipidmaps.org/pathway/pathways_maps) and extended with Scheme 1 from Acimovic et al 2013. Literature suggests that cholesterol synthesis preferentially starts with the Bloch pathway, however there is a shift to the Kandutsch-Russell part via lathosterol from Bae et al, 1997. Dashed lines indicate that multiple steps are involved to create the final product. Several regulatory effects concerning the metabolites of cholesterol have been indicated as well. The content from the Bloch and Kandutsch-Russel pathways have been checked against literature, and differences compared to the original LipidMaps pathway have been coloured turquoise.
Quality Tags
Ontology Terms
Bibliography
- Bhattacharya S, Esquivel BD, White TC; ''Overexpression or Deletion of Ergosterol Biosynthesis Genes Alters Doubling Time, Response to Stress Agents, and Drug Susceptibility in Saccharomyces cerevisiae.''; mBio, 2018 PubMed Europe PMC Scholia
- Mazein A, Watterson S, Hsieh WY, Griffiths WJ, Ghazal P; ''A comprehensive machine-readable view of the mammalian cholesterol biosynthesis pathway.''; Biochem Pharmacol, 2013 PubMed Europe PMC Scholia
- Bae SH, Paik YK; ''Cholesterol biosynthesis from lanosterol: development of a novel assay method and characterization of rat liver microsomal lanosterol delta 24-reductase.''; Biochem J, 1997 PubMed Europe PMC Scholia
- Ačimovič J, Rozman D; ''Steroidal triterpenes of cholesterol synthesis.''; Molecules, 2013 PubMed Europe PMC Scholia
History
View all... |
External references
DataNodes
View all... |
Name | Type | Database reference | Comment |
---|---|---|---|
3-keto-4alpha-methyl-zymosterol | Metabolite | LMST01010237 (LIPID MAPS) ![]() | |
32-Oxolanosterol | Metabolite | LMST01010222 (LIPID MAPS) ![]() | |
32-hydroxylanosterol | Metabolite | LMST01010124 (LIPID MAPS) ![]() | |
4,4-dimethylcholesta-8,11,24-trienol | Metabolite | LMST01010149 (LIPID MAPS) ![]() | |
4,4-dimethylzymosterol | Metabolite | LMST01010176 (LIPID MAPS) ![]() | |
4-methyl-4-carboxy zymosterone | Metabolite | LMST01010388 (LIPID MAPS) ![]() | C12CC[C@@]3([H])C(C)(COOH)[C@@H](O)CC[C@]3(C)C=1CC[C@]1(C)[C@@]([H])([C@@](C)([H])CC/C=C(\C)/C)CC[C]21H |
4alpha-methyl zymosterol | Metabolite | LMST01010202 (LIPID MAPS) ![]() | C12CC[C@@]3([H])C(C)[C@@H](O)CC[C@]3(C)C=1CC[C@]1(C)[C@@]([H])([C@@](C)([H])CC/C=C(\C)/C)CC[C]21H |
4α-carboxyzymosterol | Metabolite | LMST01010522 (LIPID MAPS) ![]() | |
4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010229 (LIPID MAPS) ![]() | |
4α-formyl-5α- cholesta-8,24-dien-3β-ol | Metabolite | LMST01010226 (LIPID MAPS) ![]() | |
4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010234 (LIPID MAPS) ![]() | |
4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | Metabolite | LMST01010232 (LIPID MAPS) ![]() | |
5-dehydroepisterol | Metabolite | LMST01030135 (LIPID MAPS) ![]() | |
Acetoacetyl-CoA | Metabolite | LMFA07050030 (LIPID MAPS) ![]() | |
Acetyl-CoA | Metabolite | LMFA07050281 (LIPID MAPS) ![]() | |
Dimethylallyl-PP | Metabolite | LMPR01010001 (LIPID MAPS) ![]() | |
ERG10 | GeneProduct | P41338 (Uniprot-TrEMBL) ![]() | |
ERG11 | Protein | P10614 (Uniprot-TrEMBL) ![]() | |
ERG12 | GeneProduct | P07277 (Uniprot-TrEMBL) ![]() | |
ERG13 | GeneProduct | P54839 (Uniprot-TrEMBL) ![]() | |
ERG19 | GeneProduct | P32377 (Uniprot-TrEMBL) ![]() | |
ERG1 | GeneProduct | P32476 (Uniprot-TrEMBL) ![]() | |
ERG24 | GeneProduct | P32462 (Uniprot-TrEMBL) ![]() | |
ERG25 | Protein | P53045 (Uniprot-TrEMBL) ![]() | |
ERG26 | GeneProduct | P53199 (Uniprot-TrEMBL) ![]() | |
ERG27 | Protein | Q12452 (Uniprot-TrEMBL) ![]() | |
ERG2 | GeneProduct | P32352 (Uniprot-TrEMBL) ![]() | |
ERG3 | GeneProduct | P32353 (Uniprot-TrEMBL) ![]() | |
ERG4 | GeneProduct | P25340 (Uniprot-TrEMBL) ![]() | |
ERG5 | GeneProduct | P54781 (Uniprot-TrEMBL) ![]() | |
ERG6 | GeneProduct | P25087 (Uniprot-TrEMBL) ![]() | |
ERG7 | GeneProduct | P38604 (Uniprot-TrEMBL) ![]() | |
ERG8 | GeneProduct | P24521 (Uniprot-TrEMBL) ![]() | |
ERG9 | GeneProduct | P29704 (Uniprot-TrEMBL) ![]() | |
Eburicol | Metabolite | LMST01031311 (LIPID MAPS) ![]() | |
Episterol | Metabolite | LMST01030115 (LIPID MAPS) ![]() | |
Ergosterol | Metabolite | LMST01030093 (LIPID MAPS) ![]() | |
Farnesyl-PP | Metabolite | LMPR0103010002 (LIPID MAPS) ![]() | |
Fecosterol | Metabolite | LMST01030095 (LIPID MAPS) ![]() | aka 24-dehydrolathosterol |
Geranyl-PP | Metabolite | LMPR0102010001 (LIPID MAPS) ![]() | |
Ggps1 | GeneProduct | 14593 (Entrez Gene) ![]() | |
HMG-CoA | Metabolite | LMFA07050116 (LIPID MAPS) ![]() | |
HMG1 | GeneProduct | P12683 (Uniprot-TrEMBL) ![]() | |
HMG2 | GeneProduct | P12684 (Uniprot-TrEMBL) ![]() | |
IDI1 | GeneProduct | P15496 (Uniprot-TrEMBL) ![]() | |
IPP | Metabolite | LMPR01010008 (LIPID MAPS) ![]() | |
Isopentenyl-PP | Metabolite | LMPR01010008 (LIPID MAPS) ![]() | |
Lanosterol | Metabolite | LMST01010017 (LIPID MAPS) ![]() | |
Mevalonate-5-P | Metabolite | LMFA01050415 (LIPID MAPS) ![]() | |
Mevalonate-5-PP | Metabolite | LMFA01050416 (LIPID MAPS) ![]() | |
Mevalonic acid | Metabolite | LMFA01050352 (LIPID MAPS) ![]() | |
PreSqualene-PP | Metabolite | LMPR0106010003 (LIPID MAPS) ![]() | Annotated while assuming this compound is actually presqualene-diphosphate |
Squalene-2,3-epoxide | Metabolite | LMPR0106010010 (LIPID MAPS) ![]() | |
Squalene | Metabolite | LMPR0106010002 (LIPID MAPS) ![]() | |
Zymosterol | Metabolite | LMST01010066 (LIPID MAPS) ![]() | |
Zymosterone | Metabolite | LMST01010168 (LIPID MAPS) ![]() | |
ergosta-5,7,22,24(28)-tetraen-3beta-ol | Metabolite | LMST01031015 (LIPID MAPS) ![]() |
Annotated Interactions
View all... |
Source | Target | Type | Database reference | Comment |
---|---|---|---|---|
3-keto-4alpha-methyl-zymosterol | 4alpha-methyl zymosterol | mim-conversion | 36380 (Rhea) ![]() | EC:1.1.1.270 |
4,4-dimethylcholesta-8,11,24-trienol | 4,4-dimethylzymosterol | mim-conversion | 18563 (Rhea) ![]() | EC:1.3.1.70 |
4,4-dimethylzymosterol | 4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 47061 (Rhea) ![]() | EC:1.14.18.9 |
4-methyl-4-carboxy zymosterone | 3-keto-4alpha-methyl-zymosterol | mim-conversion | 33448 (Rhea) ![]() | EC:1.1.1.170 |
4alpha-methyl zymosterol | 4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 46473 (Rhea) ![]() | EC:1.14.18.9 |
4α-carboxyzymosterol | Zymosterone | mim-conversion | 33456 (Rhea) ![]() | EC:1.1.1.170 |
4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | 4-methyl-4-carboxy zymosterone | mim-conversion | 47069 (Rhea) ![]() | EC:1.14.18.9 |
4α-formyl-5α- cholesta-8,24-dien-3β-ol | 4α-carboxyzymosterol | mim-conversion | 46481 (Rhea) ![]() | EC:1.14.18.9 |
4α-hydroxymethyl- 5α-cholesta-8,24-dien-3β-ol | 4α-formyl-5α- cholesta-8,24-dien-3β-ol | mim-conversion | 46477 (Rhea) ![]() | EC:1.14.18.9 |
4α-hydroxymethyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | 4α-formyl-4β-methyl- 5α-cholesta-8,24-dien-3β-ol | mim-conversion | 47065 (Rhea) ![]() | EC:1.14.18.9 |
5-dehydroepisterol | ergosta-5,7,22,24(28)-tetraen-3beta-ol | mim-conversion | 33468 (Rhea) ![]() | EC:1.14.19.41 |
Acetoacetyl-CoA | HMG-CoA | mim-conversion | 10189 (Rhea) ![]() | EC:2.3.3.10 |
Acetyl-CoA | Acetoacetyl-CoA | mim-conversion | 21037 (Rhea) ![]() | EC:2.3.1.9 |
Acetyl-CoA | HMG-CoA | mim-conversion | 10189 (Rhea) ![]() | EC:2.3.3.10 |
Dimethylallyl-PP | Geranyl-PP | mim-conversion | 22409 (Rhea) ![]() | EC:2.5.1.1 |
Episterol | 5-dehydroepisterol | mim-conversion | 46561 (Rhea) ![]() | EC:1.14.19.20 |
Farnesyl-PP | PreSqualene-PP | mim-conversion | 22673 (Rhea) ![]() | EC:2.5.1.103 |
Fecosterol | Episterol | mim-conversion | 33436 (Rhea) ![]() | |
Geranyl-PP | Farnesyl-PP | mim-conversion | 19362 (Rhea) ![]() | EC:2.5.1.10 |
HMG-CoA | Mevalonic acid | mim-conversion | 15991 (Rhea) ![]() | EC:1.1.1.34 |
IPP | Farnesyl-PP | mim-conversion | 19362 (Rhea) ![]() | EC:2.5.1.10 |
IPP | Geranyl-PP | mim-conversion | 22409 (Rhea) ![]() | EC:2.5.1.1 |
Isopentenyl-PP | Dimethylallyl-PP | mim-conversion | 23285 (Rhea) ![]() | EC:5.3.3.2 |
Mevalonate-5-P | Mevalonate-5-PP | mim-conversion | 16342 (Rhea) ![]() | EC:2.7.4.2 |
Mevalonate-5-PP | Isopentenyl-PP | mim-conversion | 23733 (Rhea) ![]() | EC:4.1.1.33 |
Mevalonic acid | Mevalonate-5-P | mim-conversion | 17066 (Rhea) ![]() | EC:2.7.1.36 |
PreSqualene-PP | Squalene | mim-conversion | 22229 (Rhea) ![]() | EC:2.5.1.103 |
Squalene-2,3-epoxide | Lanosterol | mim-conversion | 14622 (Rhea) ![]() | EC:5.4.99.7 |
Squalene | Squalene-2,3-epoxide | mim-conversion | 25283 (Rhea) ![]() | EC:1.14.14.17 |
Zymosterol | Fecosterol | mim-conversion | 34000 (Rhea) ![]() | EC:2.1.1.41 |
Zymosterone | Zymosterol | mim-conversion | 33460 (Rhea) ![]() | EC:1.1.1.270 |
ergosta-5,7,22,24(28)-tetraen-3beta-ol | Ergosterol | mim-conversion | 18503 (Rhea) ![]() | EC:1.3.1.71 |
mim-conversion | 25287 (Rhea) ![]() | EC:1.14.14.154 | ||
mim-conversion | 47056 (Rhea) ![]() | EC:1.14.18.9 | ||
mim-conversion | 52653 (Rhea) ![]() | |||
mim-conversion | 55245 (Rhea) ![]() | EC:1.14.18.9 |