Disorders of folate metabolism and transport (Homo sapiens)
From WikiPathways
Description
Folates play an essential role in one-carbon methyl transfer reactions, mediating several biological processes (e.g. DNA synthesis, epigentics by methylation, embryonic central nervous system development, cata-/anabolism of amino acids, and anabolism of thymidines, purines, and neurotransmitters. The biologically active folic acid derivative is 5,6,7,8-tetrahydrofolate (THF). Dietary folate is absorbed in the intestine, and stored in the liver for few months. [rephrased from chapter 10 of Blau et al, ISBN 3642403360 (978-3642403361)].
For more detail on MTHFR deficiency, please visit [1].
Quality Tags
Ontology Terms
Bibliography
- Fernando Scaglia, Nenad Blau; ''Disorders of Folate Metabolism and Transport''; Physician's Guide to the Diagnosis, Treatment, and Follow-Up of Inherited Metabolic diseases, chapter 10, 2014
- Yuxiang Zheng, Lewis C Cantley; ''Toward a better understanding of folate metabolism in health and disease''; J Exp Med ., 2019 PubMed Europe PMC Scholia
History
View all... |
External references
DataNodes
| View all... |
| Name | Type | Database reference | Comment |
|---|---|---|---|
| 10-Formyl-THF | Metabolite | CHEBI:15637 (ChEBI) ![]() | |
| 5,10-Methenyl-THF | Metabolite | CHEBI:15638 (ChEBI) ![]() | |
| 5,10-Methylene-THF | Metabolite | CHEBI:1989 (ChEBI) ![]() | |
| 5-Formyl-THF | Metabolite | CHEBI:15640 (ChEBI) ![]() | |
| 5-Methyl-THF | Metabolite | CHEBI:15641 (ChEBI) ![]() | |
| 5-formimino-THF | Metabolite | CHEBI:15639 (ChEBI) ![]() | |
| 7.8-dihydropterin | Metabolite | CHEBI:64277 (ChEBI) ![]() | Reference [PMID:30587505] does not provide info on stereochemistry |
| AICAR | Metabolite | CHEBI:2030 (ChEBI) ![]() | |
| AICART | Protein | P31939 (Uniprot-TrEMBL) ![]() | |
| CO2 | Metabolite | CHEBI:16526 (ChEBI) ![]() | |
| DHF | Metabolite | CHEBI:15633 (ChEBI) ![]() | AKA 7,8-DHF |
| DHFR | Protein | B0YJ76 (Uniprot-TrEMBL) ![]() | |
| DNA methylation | Pathway | WP3359 (WikiPathways) ![]() | |
| FAICAR | Metabolite | CHEBI:18381 (ChEBI) ![]() | |
| FIGLU | Protein | 2.1.2.5 (Enzyme Nomenclature) ![]() | Assumption that FIGLU stands for: Glutamate formimidoyltransferase (not mentioned in book of Blau, but enzyme seems to relate to mentioned reaction). |
| FITHFCH | Protein | O95954 (Uniprot-TrEMBL) ![]() | |
| FTHFDH | Protein | O75891 (Uniprot-TrEMBL) ![]() | |
| Folate receptor alpha | Protein | P15328 (Uniprot-TrEMBL) ![]() | |
| Folic acid | Metabolite | CHEBI:27470 (ChEBI) ![]() | |
| Formyl-GAR | Metabolite | CHEBI:18272 (ChEBI) ![]() | |
| GAR | Metabolite | CHEBI:18349 (ChEBI) ![]() | |
| GARTF | Protein | C9JKQ7 (Uniprot-TrEMBL) ![]() | |
| Homocysteine | Metabolite | CHEBI:17230 (ChEBI) ![]() | |
| L-glutamic acid | Metabolite | CHEBI:16015 (ChEBI) ![]() | |
| L-histidine | Metabolite | CHEBI:15971 (ChEBI) ![]() | |
| MS | Protein | Q99707 (Uniprot-TrEMBL) ![]() | |
| MTHFCH | Protein | 3.5.4.9 (Enzyme Nomenclature) ![]() | MTHFCH: methenyl-THF cyclohydrolase |
| MTHFD1 | Protein | P11586 (Uniprot-TrEMBL) ![]() | |
| MTHFR | Protein | P42898 (Uniprot-TrEMBL) ![]() | |
| MTHFS | Protein | ENSG00000136371 (Ensembl) ![]() | |
| Methionine | Metabolite | CHEBI:16643 (ChEBI) ![]() | |
| NH4+ | Metabolite | CHEBI:28938 (ChEBI) ![]() | |
| PCFT | Protein | Q96NT5 (Uniprot-TrEMBL) ![]() | |
| Protein methylation | Pathway | WP4073 (WikiPathways) ![]() | |
| Purine Metabolism | Pathway | WP4224 (WikiPathways) ![]() | |
| Pyrimidine metabolism | Pathway | WP4225 (WikiPathways) ![]() | |
| QDPR | Protein | P09417 (Uniprot-TrEMBL) ![]() | |
| SAH | Metabolite | CHEBI:16680 (ChEBI) ![]() | |
| SAM | Metabolite | CHEBI:67040 (ChEBI) ![]() | |
| SHMT1 | Protein | P34896 (Uniprot-TrEMBL) ![]() | |
| SHMT | Protein | P34897 (Uniprot-TrEMBL) ![]() | AKA SHMT2; Rhea and UniProt confirm the '2' addition, whereas the Blau book chapter only mentions SHMT. |
| THF | Metabolite | CHEBI:20506 (ChEBI) ![]() | |
| TS | Protein | P04818 (Uniprot-TrEMBL) ![]() | AKA TYMS |
| Vitamin B12 | Metabolite | CHEBI:30411 (ChEBI) ![]() | |
| dTMP | Metabolite | CHEBI:17013 (ChEBI) ![]() | |
| dUMP | Metabolite | CHEBI:17622 (ChEBI) ![]() | |
| formaldehyde | Metabolite | CHEBI:1684 (ChEBI) ![]() | |
| glycine | Metabolite | CHEBI:15428 (ChEBI) ![]() | |
| iminium ion | Metabolite | CHEBI:35286 (ChEBI) ![]() | |
| p-amino-benzoyl-polyglutamate | Metabolite | Reference [PMID:30587505] does not provide info on stereochemistry | |
| qDHF | Metabolite | AIZSNLNTIFEHJG-KIYNQFGBSA-N (InChIKey) ![]() | AKA quinoid DHF; SMILES: Nc1-n=C2NCC(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)N=c2C(=O)N=1 |
| serine | Metabolite | CHEBI:17822 (ChEBI) ![]() |
Annotated Interactions
| View all... |
| Source | Target | Type | Database reference | Comment |
|---|---|---|---|---|
| 5,10-Methylene-THF | mim-conversion | 12105 (Rhea) ![]() | ||
| THF | 5,10-Methylene-THF | mim-conversion | 15483 (Rhea) ![]() | |
| dTMP | mim-conversion | 12105 (Rhea) ![]() | ||
| dUMP | 12105 (Rhea) ![]() | |||
| glycine | mim-conversion | 15483 (Rhea) ![]() | ||
| serine | 15483 (Rhea) ![]() |
Saving...

